CAS 91941-04-7 is the registry number for Flupirtine Impurity 12. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]acetamide;hydrochloride (CAS 91941-04-7) is a chemical compound with the molecular formula C14H16ClFN4O and a molecular weight of 310.75 g/mol. IUPAC name: N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]acetamide;hydrochloride. InChIKey: SNFKATSAUGOEKK-UHFFFAOYSA-N.
| Molecular formula | C14H16ClFN4O |
|---|---|
| Molecular weight | 310.75 g/mol |
| IUPAC name | N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]acetamide;hydrochloride |
| InChIKey | SNFKATSAUGOEKK-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(N=C(C=C1)NCC2=CC=C(C=C2)F)N.Cl |
Computed by PubChem (NCBI)