CAS 95777-69-8 appears in our catalog under these names: D 13223 (Flupirtine Metabolite), >95% (HPLC), D 13223 (Flupirtine Metabolite), N-(2-Amino-6-((4-fluorobenzyl)amino)pyridin-3-yl)acetamide xhydrochloride, ≥98%, ≥98%. Offered by: TRC, GLPBio, Chemat. Available pack sizes: 100mg, 10mg, 250mg, 50mg.
N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]acetamide;hydrochloride (CAS 95777-69-8) is a chemical compound with the molecular formula C14H16ClFN4O and a molecular weight of 310.75 g/mol. IUPAC name: N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]acetamide;hydrochloride. InChIKey: SNFKATSAUGOEKK-UHFFFAOYSA-N.
| Molecular formula | C14H16ClFN4O |
|---|---|
| Molecular weight | 310.75 g/mol |
| IUPAC name | N-[2-amino-6-[(4-fluorophenyl)methylamino]-3-pyridinyl]acetamide;hydrochloride |
| InChIKey | SNFKATSAUGOEKK-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(N=C(C=C1)NCC2=CC=C(C=C2)F)N.Cl |
Computed by PubChem (NCBI)