Products 919528-68-0
CAS 919528-68-0 is the registry number for tert-Butyl (R)-(3-((1,1'-Biphenyl)-4-yl)-1-hydrazineyl-1-oxopropan-2-yl)carbamate. Offered by: TRC. Available pack sizes: 500mg.
Tert-butyl N-[(2R)-1-hydrazinyl-1-oxo-3-(4-phenylphenyl)propan-2-yl]carbamate (CAS 919528-68-0) is a chemical compound with the molecular formula C20H25N3O3 and a molecular weight of 355.4 g/mol. IUPAC name: tert-butyl N-[(2R)-1-hydrazinyl-1-oxo-3-(4-phenylphenyl)propan-2-yl]carbamate. InChIKey: UBGSQDPNBZUWGK-QGZVFWFLSA-N.
| Molecular formula | C20H25N3O3 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | tert-butyl N-[(2R)-1-hydrazinyl-1-oxo-3-(4-phenylphenyl)propan-2-yl]carbamate |
| InChIKey | UBGSQDPNBZUWGK-QGZVFWFLSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=C(C=C1)C2=CC=CC=C2)C(=O)NN |
Computed by PubChem (NCBI)