Products 870818-82-9

CAS 870818-82-9 is the registry number for 6-(2-Propyl-4-(pyridin-4-yldiazenyl)phenoxy)hexanoic acid 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

6-[2-propyl-4-(pyridin-4-yldiazenyl)phenoxy]hexanoic acid (CAS 870818-82-9) is a chemical compound with the molecular formula C20H25N3O3 and a molecular weight of 355.4 g/mol. IUPAC name: 6-[2-propyl-4-(pyridin-4-yldiazenyl)phenoxy]hexanoic acid. InChIKey: RKSDFQDWVOJLAU-UHFFFAOYSA-N.

Identity
Molecular formulaC20H25N3O3
Molecular weight355.4 g/mol
IUPAC name6-[2-propyl-4-(pyridin-4-yldiazenyl)phenoxy]hexanoic acid
InChIKeyRKSDFQDWVOJLAU-UHFFFAOYSA-N
SMILESCCCC1=C(C=CC(=C1)N=NC2=CC=NC=C2)OCCCCCC(=O)O

Computed by PubChem (NCBI)