Products 52184-17-5
CAS 52184-17-5 is the registry number for 4-(1,1-Dimethylethyl)-2-(1-methylpropyl)-6-(2-(2-nitrophenyl)diazenyl)phenol. Offered by: TRC. Available pack sizes: 500mg.
2-butan-2-yl-4-tert-butyl-6-[(2-nitrophenyl)diazenyl]phenol (CAS 52184-17-5) is a chemical compound with the molecular formula C20H25N3O3 and a molecular weight of 355.4 g/mol. IUPAC name: 2-butan-2-yl-4-tert-butyl-6-[(2-nitrophenyl)diazenyl]phenol. InChIKey: DOSSDAPEMRMHCI-UHFFFAOYSA-N.
| Molecular formula | C20H25N3O3 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | 2-butan-2-yl-4-tert-butyl-6-[(2-nitrophenyl)diazenyl]phenol |
| InChIKey | DOSSDAPEMRMHCI-UHFFFAOYSA-N |
| SMILES | CCC(C)C1=C(C(=CC(=C1)C(C)(C)C)N=NC2=CC=CC=C2[N+](=O)[O-])O |
Computed by PubChem (NCBI)