CAS 919789-80-3 appears in our catalog under these names: 4–(1,2,2–Triphenylvinyl)aniline, 4-(1,2,2-Triphenylvinyl)aniline 98%, 4-(1,2,2-Triphenylethenyl)benzenamine, 98%, 98%, 4-(1,2,2-Triphenylvinyl)aniline, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100g, 100mg, 250mg.
4-(1,2,2-triphenylethenyl)aniline (CAS 919789-80-3) is a chemical compound with the molecular formula C26H21N and a molecular weight of 347.4 g/mol. IUPAC name: 4-(1,2,2-triphenylethenyl)aniline. InChIKey: WCNQRPKNQRXHQJ-UHFFFAOYSA-N.
| Molecular formula | C26H21N |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 4-(1,2,2-triphenylethenyl)aniline |
| InChIKey | WCNQRPKNQRXHQJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC=C(C=C3)N)C4=CC=CC=C4 |
Computed by PubChem (NCBI)