CAS 91983-44-7 appears in our catalog under these names: 2-(4H-1,2,4-Triazol-3-yl)phenol, 98%, 2-(4H-1,2,4-Triazol-3-yl)phenol, 2-(4h-1,2,4-Triazol-3-yl)phenol, 98%, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 0,5g, 100mg, 250mg, 500mg, 1g, 2.5g.
2-(1H-1,2,4-triazol-5-yl)phenol (CAS 91983-44-7) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: 2-(1H-1,2,4-triazol-5-yl)phenol. InChIKey: XOPCCOBUMDDPJG-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 2-(1H-1,2,4-triazol-5-yl)phenol |
| InChIKey | XOPCCOBUMDDPJG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC=NN2)O |
Computed by PubChem (NCBI)