CAS 919974-50-8 is the registry number for RORC modulator-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(3-acetylphenyl)-1-ethyl-2-oxobenzo[cd]indole-6-sulfonamide (CAS 919974-50-8) is a chemical compound with the molecular formula C21H18N2O4S and a molecular weight of 394.4 g/mol. IUPAC name: N-(3-acetylphenyl)-1-ethyl-2-oxobenzo[cd]indole-6-sulfonamide. InChIKey: GUQFBNIBOLNMAM-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O4S |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | N-(3-acetylphenyl)-1-ethyl-2-oxobenzo[cd]indole-6-sulfonamide |
| InChIKey | GUQFBNIBOLNMAM-UHFFFAOYSA-N |
| SMILES | CCN1C2=C3C(=C(C=C2)S(=O)(=O)NC4=CC=CC(=C4)C(=O)C)C=CC=C3C1=O |
Computed by PubChem (NCBI)