Products 919988-15-1

CAS 919988-15-1 is the registry number for Prop-2-yn-1-yl 2,2,5-trimethyl-1,3-dioxane-5-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Prop-2-ynyl 2,2,5-trimethyl-1,3-dioxane-5-carboxylate (CAS 919988-15-1) is a chemical compound with the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. IUPAC name: prop-2-ynyl 2,2,5-trimethyl-1,3-dioxane-5-carboxylate. InChIKey: BJZJWAJSOZCNEU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16O4
Molecular weight212.24 g/mol
IUPAC nameprop-2-ynyl 2,2,5-trimethyl-1,3-dioxane-5-carboxylate
InChIKeyBJZJWAJSOZCNEU-UHFFFAOYSA-N
SMILESCC1(OCC(CO1)(C)C(=O)OCC#C)C

Computed by PubChem (NCBI)