CAS 92-05-7 is the registry number for 3.4-Biphenyldiol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-phenylbenzene-1,2-diol (CAS 92-05-7) is a chemical compound with the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol. IUPAC name: 4-phenylbenzene-1,2-diol. InChIKey: QDNPCYCBQFHNJC-UHFFFAOYSA-N.
| Molecular formula | C12H10O2 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 4-phenylbenzene-1,2-diol |
| InChIKey | QDNPCYCBQFHNJC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)O)O |
Computed by PubChem (NCBI)