CAS 920112-75-0 appears in our catalog under these names: 4–(tert–Butyl)picolinamide, 4-(tert-Butyl)picolinamide 95%, 4-(tert-Butyl)picolinamide, 95%, 95%, 2-Pyridinecarboxamide, 4-(1,1-dimethylethyl)-, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-tert-butylpyridine-2-carboxamide (CAS 920112-75-0) is a chemical compound with the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. IUPAC name: 4-tert-butylpyridine-2-carboxamide. InChIKey: NXHJSKHLRMSGDI-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 4-tert-butylpyridine-2-carboxamide |
| InChIKey | NXHJSKHLRMSGDI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=NC=C1)C(=O)N |
Computed by PubChem (NCBI)