CAS 920113-03-7 appears in our catalog under these names: Riviciclib HCl, 99+%, P276–00, Riviciclib hydrochloride/ 99.36% (existing batch purity), P276-00, 99.51% ,, 99.51% ,, Riviciclib hydrochloride, 99.08%. Offered by: AmBeed, GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 25mg, 100mg, 10mg, 2mg, 5mg, 10mM (in 1ml dmso), 50mg, 1mg.
2-(2-chlorophenyl)-5,7-dihydroxy-8-[(2R,3S)-2-(hydroxymethyl)-1-methylpyrrolidin-3-yl]chromen-4-one;hydrochloride (CAS 920113-03-7) is a chemical compound with the molecular formula C21H21Cl2NO5 and a molecular weight of 438.3 g/mol. IUPAC name: 2-(2-chlorophenyl)-5,7-dihydroxy-8-[(2R,3S)-2-(hydroxymethyl)-1-methylpyrrolidin-3-yl]chromen-4-one;hydrochloride. InChIKey: OOVTUOCTLAERQD-OJMBIDBESA-N.
| Molecular formula | C21H21Cl2NO5 |
|---|---|
| Molecular weight | 438.3 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-5,7-dihydroxy-8-[(2R,3S)-2-(hydroxymethyl)-1-methylpyrrolidin-3-yl]chromen-4-one;hydrochloride |
| InChIKey | OOVTUOCTLAERQD-OJMBIDBESA-N |
| SMILES | CN1CC[C@H]([C@@H]1CO)C2=C(C=C(C3=C2OC(=CC3=O)C4=CC=CC=C4Cl)O)O.Cl |
Computed by PubChem (NCBI)