CAS 92119-04-5 is the registry number for Tamsulosin Impurity 31. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl 3-(4-methoxyphenyl)-2-methyloxirane-2-carboxylate (CAS 92119-04-5) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: methyl 3-(4-methoxyphenyl)-2-methyloxirane-2-carboxylate. InChIKey: MGYLOFAWLACZEE-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | methyl 3-(4-methoxyphenyl)-2-methyloxirane-2-carboxylate |
| InChIKey | MGYLOFAWLACZEE-UHFFFAOYSA-N |
| SMILES | CC1(C(O1)C2=CC=C(C=C2)OC)C(=O)OC |
Computed by PubChem (NCBI)