CAS 921195-93-9 appears in our catalog under these names: (S)–3–(4–Aminophenyl)–2–methoxypropanoic acid, (S)-3-(4-Aminophenyl)-2-methoxypropanoic acid, (S)-3-(4-Aminophenyl)-2-methoxypropanoic acid 98%, (S)-3-(4-Aminophenyl)-2-methoxypropanoic acid, 98%, 98%, GED 0507-34-Levo. Offered by: GLPBio, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 50mg, 500mg, 1000mg, 100mg, 250mg, 1g, Get quote.
(2S)-3-(4-aminophenyl)-2-methoxypropanoic acid (CAS 921195-93-9) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: (2S)-3-(4-aminophenyl)-2-methoxypropanoic acid. InChIKey: QLJYLJGYIDIJPT-VIFPVBQESA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | (2S)-3-(4-aminophenyl)-2-methoxypropanoic acid |
| InChIKey | QLJYLJGYIDIJPT-VIFPVBQESA-N |
| SMILES | CO[C@@H](CC1=CC=C(C=C1)N)C(=O)O |
Computed by PubChem (NCBI)