Products 921224-78-4
CAS 921224-78-4 is the registry number for H-alpha-Tfm-L-AllGly-OH. Offered by: Iris Biotech. Available pack sizes: 250mg, 500mg, 1g.
(2S)-2-amino-2-(trifluoromethyl)pent-4-enoic acid (CAS 921224-78-4) is a chemical compound with the molecular formula C6H8F3NO2 and a molecular weight of 183.13 g/mol. IUPAC name: (2S)-2-amino-2-(trifluoromethyl)pent-4-enoic acid. InChIKey: MRIDMQLMUYGBCW-YFKPBYRVSA-N.
| Molecular formula | C6H8F3NO2 |
|---|---|
| Molecular weight | 183.13 g/mol |
| IUPAC name | (2S)-2-amino-2-(trifluoromethyl)pent-4-enoic acid |
| InChIKey | MRIDMQLMUYGBCW-YFKPBYRVSA-N |
| SMILES | C=CC[C@](C(=O)O)(C(F)(F)F)N |
Computed by PubChem (NCBI)