CAS 92126-72-2 is the registry number for 6-Phenyl-2-sulfanylpyridine-3-carbonitrile. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
6-phenyl-2-sulfanylidene-1H-pyridine-3-carbonitrile (CAS 92126-72-2) is a chemical compound with the molecular formula C12H8N2S and a molecular weight of 212.27 g/mol. IUPAC name: 6-phenyl-2-sulfanylidene-1H-pyridine-3-carbonitrile. InChIKey: XJUANYPYIQLJEC-UHFFFAOYSA-N.
| Molecular formula | C12H8N2S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | 6-phenyl-2-sulfanylidene-1H-pyridine-3-carbonitrile |
| InChIKey | XJUANYPYIQLJEC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C(=S)N2)C#N |
Computed by PubChem (NCBI)