Products 922510-19-8
CAS 922510-19-8 appears in our catalog under these names: 2-Phenanthrol-d9 (Major), 2–Phenanthrol–d9, 2-Phenanthrol-d9. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg.
1,3,4,5,6,7,8,9,10-nonadeuteriophenanthren-2-ol (CAS 922510-19-8) is a chemical compound with the molecular formula C14H10O and a molecular weight of 203.28 g/mol. IUPAC name: 1,3,4,5,6,7,8,9,10-nonadeuteriophenanthren-2-ol. InChIKey: YPWLZGITFNGGKW-LOIXRAQWSA-N.
| Molecular formula | C14H10O |
|---|---|
| Molecular weight | 203.28 g/mol |
| IUPAC name | 1,3,4,5,6,7,8,9,10-nonadeuteriophenanthren-2-ol |
| InChIKey | YPWLZGITFNGGKW-LOIXRAQWSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(C3=C2C(=C(C(=C3[2H])O)[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)