Products 922730-86-7
CAS 922730-86-7 appears in our catalog under these names: 5-(Methoxy-d3)-2-mercaptobenzimidazole, 5-(Methoxy-d3)-1H-benzo[d]imidazole-2-thiol. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 100 mg, 10 mg.
5-(trideuteriomethoxy)-1,3-dihydrobenzimidazole-2-thione (CAS 922730-86-7) is a chemical compound with the molecular formula C8H8N2OS and a molecular weight of 183.25 g/mol. IUPAC name: 5-(trideuteriomethoxy)-1,3-dihydrobenzimidazole-2-thione. InChIKey: KOFBRZWVWJCLGM-FIBGUPNXSA-N.
| Molecular formula | C8H8N2OS |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | 5-(trideuteriomethoxy)-1,3-dihydrobenzimidazole-2-thione |
| InChIKey | KOFBRZWVWJCLGM-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC2=C(C=C1)NC(=S)N2 |
Computed by PubChem (NCBI)