CAS 923022-43-9 appears in our catalog under these names: 7-Bromo-6-fluoroisoquinolin-1(2H)-one, 97%, 7-Bromo-6-fluoro-1,2-dihydroisoquinolin-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
7-bromo-6-fluoro-2H-isoquinolin-1-one (CAS 923022-43-9) is a chemical compound with the molecular formula C9H5BrFNO and a molecular weight of 242.04 g/mol. IUPAC name: 7-bromo-6-fluoro-2H-isoquinolin-1-one. InChIKey: QLALLSRWJRAJOS-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFNO |
|---|---|
| Molecular weight | 242.04 g/mol |
| IUPAC name | 7-bromo-6-fluoro-2H-isoquinolin-1-one |
| InChIKey | QLALLSRWJRAJOS-UHFFFAOYSA-N |
| SMILES | C1=CNC(=O)C2=CC(=C(C=C21)F)Br |
Computed by PubChem (NCBI)