CAS 923170-31-4 is the registry number for N-(1-(4-Methylbenzenesulfonyl)piperidin-4-ylidene)hydroxylamine. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
N-[1-(4-methylphenyl)sulfonylpiperidin-4-ylidene]hydroxylamine (CAS 923170-31-4) is a chemical compound with the molecular formula C12H16N2O3S and a molecular weight of 268.33 g/mol. IUPAC name: N-[1-(4-methylphenyl)sulfonylpiperidin-4-ylidene]hydroxylamine. InChIKey: XNYUJPALTFDUNZ-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O3S |
|---|---|
| Molecular weight | 268.33 g/mol |
| IUPAC name | N-[1-(4-methylphenyl)sulfonylpiperidin-4-ylidene]hydroxylamine |
| InChIKey | XNYUJPALTFDUNZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCC(=NO)CC2 |
Computed by PubChem (NCBI)