Products 923171-94-2
CAS 923171-94-2 appears in our catalog under these names: 1-(2-Fluoro-4-methylphenyl)-5-oxopyrrolidine-3-carboxylic acid, 95%, 95%, 1-(2-Fluoro-4-methylphenyl)-5-oxopyrrolidine-3-carboxylic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g.
1-(2-fluoro-4-methylphenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 923171-94-2) is a chemical compound with the molecular formula C12H12FNO3 and a molecular weight of 237.23 g/mol. IUPAC name: 1-(2-fluoro-4-methylphenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: JVHLLKSGJDLKIZ-UHFFFAOYSA-N.
| Molecular formula | C12H12FNO3 |
|---|---|
| Molecular weight | 237.23 g/mol |
| IUPAC name | 1-(2-fluoro-4-methylphenyl)-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | JVHLLKSGJDLKIZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2CC(CC2=O)C(=O)O)F |
Computed by PubChem (NCBI)