CAS 923276-08-8 appears in our catalog under these names: 4-Methyl-L-phenylalanine 1,1-dimethylethyl ester, 97%, tert-butyl (2S)-2-amino-3-(4-methylphenyl)propanoate, 97%, 97%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g, 10g.
Tert-butyl (2S)-2-amino-3-(4-methylphenyl)propanoate (CAS 923276-08-8) is a chemical compound with the molecular formula C14H21NO2 and a molecular weight of 235.32 g/mol. IUPAC name: tert-butyl (2S)-2-amino-3-(4-methylphenyl)propanoate. InChIKey: FNWRKKNMDIEZIT-LBPRGKRZSA-N.
| Molecular formula | C14H21NO2 |
|---|---|
| Molecular weight | 235.32 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-3-(4-methylphenyl)propanoate |
| InChIKey | FNWRKKNMDIEZIT-LBPRGKRZSA-N |
| SMILES | CC1=CC=C(C=C1)C[C@@H](C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)