CAS 923676-77-1 is the registry number for 1-(3-Hydroxyphenyl)-3,3-dimethylazetidin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-(3-hydroxyphenyl)-3,3-dimethylazetidin-2-one (CAS 923676-77-1) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: 1-(3-hydroxyphenyl)-3,3-dimethylazetidin-2-one. InChIKey: PFUNBEQTYUMLIS-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 1-(3-hydroxyphenyl)-3,3-dimethylazetidin-2-one |
| InChIKey | PFUNBEQTYUMLIS-UHFFFAOYSA-N |
| SMILES | CC1(CN(C1=O)C2=CC(=CC=C2)O)C |
Computed by PubChem (NCBI)