Products 923747-62-0
CAS 923747-62-0 is the registry number for Ethyl 4-amino-2,5-dimethylthieno(2,3-d)pyrimidine-6-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
Ethyl 4-amino-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate (CAS 923747-62-0) is a chemical compound with the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. IUPAC name: ethyl 4-amino-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate. InChIKey: OMDWYJFDWFUGEN-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2S |
|---|---|
| Molecular weight | 251.31 g/mol |
| IUPAC name | ethyl 4-amino-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate |
| InChIKey | OMDWYJFDWFUGEN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(N=C(N=C2S1)C)N)C |
Computed by PubChem (NCBI)