CAS 923751-96-6 is the registry number for 2-Cyclopropyl-7-fluoroquinoline-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-cyclopropyl-7-fluoroquinoline-4-carboxylic acid (CAS 923751-96-6) is a chemical compound with the molecular formula C13H10FNO2 and a molecular weight of 231.22 g/mol. IUPAC name: 2-cyclopropyl-7-fluoroquinoline-4-carboxylic acid. InChIKey: TVXRYZZREWPGFK-UHFFFAOYSA-N.
| Molecular formula | C13H10FNO2 |
|---|---|
| Molecular weight | 231.22 g/mol |
| IUPAC name | 2-cyclopropyl-7-fluoroquinoline-4-carboxylic acid |
| InChIKey | TVXRYZZREWPGFK-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC3=C(C=CC(=C3)F)C(=C2)C(=O)O |
Computed by PubChem (NCBI)