Products 924012-02-2
CAS 924012-02-2 appears in our catalog under these names: (S)-2-((2-Hydroxy-1-phenylethyl)amino)acetic Acid, Eliglustat Impurity 7. Offered by: TRC, Biosynth, Hubei YoungXin. Available pack sizes: 250mg, 500mg, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[[(1S)-2-hydroxy-1-phenylethyl]amino]acetic acid (CAS 924012-02-2) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 2-[[(1S)-2-hydroxy-1-phenylethyl]amino]acetic acid. InChIKey: YBRCUAIBQWDEKS-SECBINFHSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | 2-[[(1S)-2-hydroxy-1-phenylethyl]amino]acetic acid |
| InChIKey | YBRCUAIBQWDEKS-SECBINFHSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](CO)NCC(=O)O |
Computed by PubChem (NCBI)