CAS 92418-40-1 is the registry number for D-Psicose 1-Phosphate Barium salt. Offered by: TRC. Available pack sizes: 5mg.
Barium(2+);[(3R,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] dihydrogen phosphate (CAS 92418-40-1) is a chemical compound with the molecular formula C6H13BaO9P+2 and a molecular weight of 397.46 g/mol. IUPAC name: barium(2+);[(3R,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] dihydrogen phosphate. InChIKey: PVYXSCGRJSOHGH-IWIWCEOHSA-N.
| Molecular formula | C6H13BaO9P+2 |
|---|---|
| Molecular weight | 397.46 g/mol |
| IUPAC name | barium(2+);[(3R,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] dihydrogen phosphate |
| InChIKey | PVYXSCGRJSOHGH-IWIWCEOHSA-N |
| SMILES | C([C@H]([C@H]([C@H](C(=O)COP(=O)(O)O)O)O)O)O.[Ba+2] |
Computed by PubChem (NCBI)