CAS 53823-70-4 appears in our catalog under these names: D-Fructose 1-phosphate Barium Salt, D-Fructose 1-phosphate barium salt trihydrate. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 2mg, 1mg, 5mg, 25mg, 10mg.
Barium(2+);[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] phosphate (CAS 53823-70-4) is a chemical compound with the molecular formula C6H11BaO9P and a molecular weight of 395.45 g/mol. IUPAC name: barium(2+);[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] phosphate. InChIKey: PVYXSCGRJSOHGH-BAOOBMCLSA-L.
| Molecular formula | C6H11BaO9P |
|---|---|
| Molecular weight | 395.45 g/mol |
| IUPAC name | barium(2+);[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] phosphate |
| InChIKey | PVYXSCGRJSOHGH-BAOOBMCLSA-L |
| SMILES | C([C@H]([C@H]([C@@H](C(=O)COP(=O)([O-])[O-])O)O)O)O.[Ba+2] |
Computed by PubChem (NCBI)