CAS 924271-35-2 appears in our catalog under these names: 7-Bromo-1-chloro-6-methoxyisoquinoline, 95+%, 1–Chloro–6–methoxy–7–bromoisoquinoline. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 5g, 250mg.
7-bromo-1-chloro-6-methoxyisoquinoline (CAS 924271-35-2) is a chemical compound with the molecular formula C10H7BrClNO and a molecular weight of 272.52 g/mol. IUPAC name: 7-bromo-1-chloro-6-methoxyisoquinoline. InChIKey: PPIUOJLFVXPVET-UHFFFAOYSA-N.
| Molecular formula | C10H7BrClNO |
|---|---|
| Molecular weight | 272.52 g/mol |
| IUPAC name | 7-bromo-1-chloro-6-methoxyisoquinoline |
| InChIKey | PPIUOJLFVXPVET-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=CN=C2Cl)Br |
Computed by PubChem (NCBI)