CAS 925207-04-1 is the registry number for 5-Fluoro-3'-methylbiphenyl-2-amine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
4-fluoro-2-(3-methylphenyl)aniline (CAS 925207-04-1) is a chemical compound with the molecular formula C13H12FN and a molecular weight of 201.24 g/mol. IUPAC name: 4-fluoro-2-(3-methylphenyl)aniline. InChIKey: XDLDVVGGQNYHEJ-UHFFFAOYSA-N.
| Molecular formula | C13H12FN |
|---|---|
| Molecular weight | 201.24 g/mol |
| IUPAC name | 4-fluoro-2-(3-methylphenyl)aniline |
| InChIKey | XDLDVVGGQNYHEJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=C(C=CC(=C2)F)N |
Computed by PubChem (NCBI)