Products 925207-04-1

CAS 925207-04-1 is the registry number for 5-Fluoro-3'-methylbiphenyl-2-amine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

4-fluoro-2-(3-methylphenyl)aniline (CAS 925207-04-1) is a chemical compound with the molecular formula C13H12FN and a molecular weight of 201.24 g/mol. IUPAC name: 4-fluoro-2-(3-methylphenyl)aniline. InChIKey: XDLDVVGGQNYHEJ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12FN
Molecular weight201.24 g/mol
IUPAC name4-fluoro-2-(3-methylphenyl)aniline
InChIKeyXDLDVVGGQNYHEJ-UHFFFAOYSA-N
SMILESCC1=CC(=CC=C1)C2=C(C=CC(=C2)F)N

Computed by PubChem (NCBI)