CAS 925252-32-0 is the registry number for (Z)-2-(3-fluorophenyl)-N'-hydroxyethenimidamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
2-(3-fluorophenyl)-N'-hydroxyethanimidamide (CAS 925252-32-0) is a chemical compound with the molecular formula C8H9FN2O and a molecular weight of 168.17 g/mol. IUPAC name: 2-(3-fluorophenyl)-N'-hydroxyethanimidamide. InChIKey: MOSPBYILTXWKJK-UHFFFAOYSA-N.
| Molecular formula | C8H9FN2O |
|---|---|
| Molecular weight | 168.17 g/mol |
| IUPAC name | 2-(3-fluorophenyl)-N'-hydroxyethanimidamide |
| InChIKey | MOSPBYILTXWKJK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C/C(=N/O)/N |
Computed by PubChem (NCBI)