CAS 925252-83-1 is the registry number for 1-Naphthaleneethanimidamide, n-hydroxy-, [c(z)]-, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N'-hydroxy-2-naphthalen-1-ylethanimidamide (CAS 925252-83-1) is a chemical compound with the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. IUPAC name: N'-hydroxy-2-naphthalen-1-ylethanimidamide. InChIKey: NWWCOKUDFCFADE-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O |
|---|---|
| Molecular weight | 200.24 g/mol |
| IUPAC name | N'-hydroxy-2-naphthalen-1-ylethanimidamide |
| InChIKey | NWWCOKUDFCFADE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C/C(=N/O)/N |
Computed by PubChem (NCBI)