Products 92549-30-9

CAS 92549-30-9 is the registry number for 2-(Biphenyl-3-yloxy)-propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(3-phenylphenoxy)propanoic acid (CAS 92549-30-9) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 2-(3-phenylphenoxy)propanoic acid. InChIKey: TYLSLBBNQFQBKW-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14O3
Molecular weight242.27 g/mol
IUPAC name2-(3-phenylphenoxy)propanoic acid
InChIKeyTYLSLBBNQFQBKW-UHFFFAOYSA-N
SMILESCC(C(=O)O)OC1=CC=CC(=C1)C2=CC=CC=C2

Computed by PubChem (NCBI)