CAS 925889-73-2 appears in our catalog under these names: 1-(3-Cyano-benzyl)-3-formyl-1h-indole-5-carboxylic acid methyl ester, 95%, Methyl 1-(3-cyanobenzyl)-3-formyl-1H-indole-5-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Methyl 1-[(3-cyanophenyl)methyl]-3-formylindole-5-carboxylate (CAS 925889-73-2) is a chemical compound with the molecular formula C19H14N2O3 and a molecular weight of 318.3 g/mol. IUPAC name: methyl 1-[(3-cyanophenyl)methyl]-3-formylindole-5-carboxylate. InChIKey: BDTZUDCWVBUYMI-UHFFFAOYSA-N.
| Molecular formula | C19H14N2O3 |
|---|---|
| Molecular weight | 318.3 g/mol |
| IUPAC name | methyl 1-[(3-cyanophenyl)methyl]-3-formylindole-5-carboxylate |
| InChIKey | BDTZUDCWVBUYMI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)N(C=C2C=O)CC3=CC(=CC=C3)C#N |
Computed by PubChem (NCBI)