Products 94212-33-6
CAS 94212-33-6 is the registry number for BC12-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
(5E)-1-phenyl-5-[(E)-3-phenylprop-2-enylidene]-1,3-diazinane-2,4,6-trione (CAS 94212-33-6) is a chemical compound with the molecular formula C19H14N2O3 and a molecular weight of 318.3 g/mol. IUPAC name: (5E)-1-phenyl-5-[(E)-3-phenylprop-2-enylidene]-1,3-diazinane-2,4,6-trione. InChIKey: COXDMRSXWPMFJU-NJKRNUQASA-N.
| Molecular formula | C19H14N2O3 |
|---|---|
| Molecular weight | 318.3 g/mol |
| IUPAC name | (5E)-1-phenyl-5-[(E)-3-phenylprop-2-enylidene]-1,3-diazinane-2,4,6-trione |
| InChIKey | COXDMRSXWPMFJU-NJKRNUQASA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C=C/2\C(=O)NC(=O)N(C2=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)