CAS 926204-45-7 appears in our catalog under these names: N-(4-Amino-2,6-dichlorophenyl)thiophene-3-carboxamide, 95%, N-(4-Amino-2,6-dichlorophenyl)thiophene-3-carboxamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
N-(4-amino-2,6-dichlorophenyl)thiophene-3-carboxamide (CAS 926204-45-7) is a chemical compound with the molecular formula C11H8Cl2N2OS and a molecular weight of 287.2 g/mol. IUPAC name: N-(4-amino-2,6-dichlorophenyl)thiophene-3-carboxamide. InChIKey: CNRKJWWBOCRPQC-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2OS |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | N-(4-amino-2,6-dichlorophenyl)thiophene-3-carboxamide |
| InChIKey | CNRKJWWBOCRPQC-UHFFFAOYSA-N |
| SMILES | C1=CSC=C1C(=O)NC2=C(C=C(C=C2Cl)N)Cl |
Computed by PubChem (NCBI)