Products 959575-95-2
CAS 959575-95-2 is the registry number for S-(4-Chlorophenyl) 5-chloro-1-methyl-1H-pyrazole-4-carbothioate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
S-(4-chlorophenyl) 5-chloro-1-methylpyrazole-4-carbothioate (CAS 959575-95-2) is a chemical compound with the molecular formula C11H8Cl2N2OS and a molecular weight of 287.2 g/mol. IUPAC name: S-(4-chlorophenyl) 5-chloro-1-methylpyrazole-4-carbothioate. InChIKey: WEHMNNOFDFRYCP-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2OS |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | S-(4-chlorophenyl) 5-chloro-1-methylpyrazole-4-carbothioate |
| InChIKey | WEHMNNOFDFRYCP-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)C(=O)SC2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)