Products 926227-65-8
CAS 926227-65-8 is the registry number for 5-(Azetidine-1-sulfonyl)-2-chlorobenzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(azetidin-1-ylsulfonyl)-2-chlorobenzoic acid (CAS 926227-65-8) is a chemical compound with the molecular formula C10H10ClNO4S and a molecular weight of 275.71 g/mol. IUPAC name: 5-(azetidin-1-ylsulfonyl)-2-chlorobenzoic acid. InChIKey: IHNFRVXFWWBLJF-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO4S |
|---|---|
| Molecular weight | 275.71 g/mol |
| IUPAC name | 5-(azetidin-1-ylsulfonyl)-2-chlorobenzoic acid |
| InChIKey | IHNFRVXFWWBLJF-UHFFFAOYSA-N |
| SMILES | C1CN(C1)S(=O)(=O)C2=CC(=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)