Products 926231-44-9

CAS 926231-44-9 appears in our catalog under these names: 2,6-Difluoro-3-sulfamoylbenzoic acid, 95%, 2,6-Difluoro-3-sulfamoylbenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.

2,6-difluoro-3-sulfamoylbenzoic acid (CAS 926231-44-9) is a chemical compound with the molecular formula C7H5F2NO4S and a molecular weight of 237.18 g/mol. IUPAC name: 2,6-difluoro-3-sulfamoylbenzoic acid. InChIKey: DOICEDZDWRQKRJ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5F2NO4S
Molecular weight237.18 g/mol
IUPAC name2,6-difluoro-3-sulfamoylbenzoic acid
InChIKeyDOICEDZDWRQKRJ-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1F)C(=O)O)F)S(=O)(=O)N

Computed by PubChem (NCBI)