Products 926238-33-7

CAS 926238-33-7 is the registry number for 3,4-Difluoro-5-sulfamoylbenzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3,4-difluoro-5-sulfamoylbenzoic acid (CAS 926238-33-7) is a chemical compound with the molecular formula C7H5F2NO4S and a molecular weight of 237.18 g/mol. IUPAC name: 3,4-difluoro-5-sulfamoylbenzoic acid. InChIKey: AVRGLOXFKJWMPA-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5F2NO4S
Molecular weight237.18 g/mol
IUPAC name3,4-difluoro-5-sulfamoylbenzoic acid
InChIKeyAVRGLOXFKJWMPA-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1F)F)S(=O)(=O)N)C(=O)O

Computed by PubChem (NCBI)