CAS 926238-33-7 is the registry number for 3,4-Difluoro-5-sulfamoylbenzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3,4-difluoro-5-sulfamoylbenzoic acid (CAS 926238-33-7) is a chemical compound with the molecular formula C7H5F2NO4S and a molecular weight of 237.18 g/mol. IUPAC name: 3,4-difluoro-5-sulfamoylbenzoic acid. InChIKey: AVRGLOXFKJWMPA-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO4S |
|---|---|
| Molecular weight | 237.18 g/mol |
| IUPAC name | 3,4-difluoro-5-sulfamoylbenzoic acid |
| InChIKey | AVRGLOXFKJWMPA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)S(=O)(=O)N)C(=O)O |
Computed by PubChem (NCBI)