CAS 1226233-39-1 is the registry number for 1-(2-(2-Methylphenyl)-1,3-thiazol-5-yl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-[2-(2-methylphenyl)-1,3-thiazol-5-yl]ethanone (CAS 1226233-39-1) is a chemical compound with the molecular formula C12H11NOS and a molecular weight of 217.29 g/mol. IUPAC name: 1-[2-(2-methylphenyl)-1,3-thiazol-5-yl]ethanone. InChIKey: BOEUYFSEXWUVNG-UHFFFAOYSA-N.
| Molecular formula | C12H11NOS |
|---|---|
| Molecular weight | 217.29 g/mol |
| IUPAC name | 1-[2-(2-methylphenyl)-1,3-thiazol-5-yl]ethanone |
| InChIKey | BOEUYFSEXWUVNG-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=NC=C(S2)C(=O)C |
Computed by PubChem (NCBI)