CAS 926249-18-5 is the registry number for 2-{tetramethyl-1H-pyrazolo(3,4-b)pyridin-5-yl}acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(1,3,4,6-tetramethylpyrazolo[5,4-b]pyridin-5-yl)acetic acid (CAS 926249-18-5) is a chemical compound with the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. IUPAC name: 2-(1,3,4,6-tetramethylpyrazolo[5,4-b]pyridin-5-yl)acetic acid. InChIKey: IKKAJNUHDWIDBE-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O2 |
|---|---|
| Molecular weight | 233.27 g/mol |
| IUPAC name | 2-(1,3,4,6-tetramethylpyrazolo[5,4-b]pyridin-5-yl)acetic acid |
| InChIKey | IKKAJNUHDWIDBE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC2=C1C(=NN2C)C)C)CC(=O)O |
Computed by PubChem (NCBI)