Products 926257-94-5
CAS 926257-94-5 appears in our catalog under these names: 4-Amino-n-isopropyl-3-methylbenzamide, 95%, 4-Amino-3-methyl-N-(propan-2-yl)benzamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g.
4-amino-3-methyl-N-propan-2-ylbenzamide (CAS 926257-94-5) is a chemical compound with the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. IUPAC name: 4-amino-3-methyl-N-propan-2-ylbenzamide. InChIKey: RXNCBCWEWIPAST-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O |
|---|---|
| Molecular weight | 192.26 g/mol |
| IUPAC name | 4-amino-3-methyl-N-propan-2-ylbenzamide |
| InChIKey | RXNCBCWEWIPAST-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)NC(C)C)N |
Computed by PubChem (NCBI)