CAS 92721-83-0 appears in our catalog under these names: 3-Methyl-1-(3-methylphenyl)-1h-pyrazol-5-amine, 95%, 3–Methyl–1–m–tolyl–1H–pyrazol–5–amine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 100mg, 250mg.
5-methyl-2-(3-methylphenyl)pyrazol-3-amine (CAS 92721-83-0) is a chemical compound with the molecular formula C11H13N3 and a molecular weight of 187.24 g/mol. IUPAC name: 5-methyl-2-(3-methylphenyl)pyrazol-3-amine. InChIKey: HRJSLUPAMXKPPM-UHFFFAOYSA-N.
| Molecular formula | C11H13N3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 5-methyl-2-(3-methylphenyl)pyrazol-3-amine |
| InChIKey | HRJSLUPAMXKPPM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2C(=CC(=N2)C)N |
Computed by PubChem (NCBI)