Products 92751-45-6
CAS 92751-45-6 is the registry number for LS 82-556. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,6-dimethyl-N-[(1S)-1-phenylethyl]-5-propanoylpyridine-3-carboxamide (CAS 92751-45-6) is a chemical compound with the molecular formula C19H22N2O2 and a molecular weight of 310.4 g/mol. IUPAC name: 2,6-dimethyl-N-[(1S)-1-phenylethyl]-5-propanoylpyridine-3-carboxamide. InChIKey: HSUOFZJUZZRIOL-LBPRGKRZSA-N.
| Molecular formula | C19H22N2O2 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 2,6-dimethyl-N-[(1S)-1-phenylethyl]-5-propanoylpyridine-3-carboxamide |
| InChIKey | HSUOFZJUZZRIOL-LBPRGKRZSA-N |
| SMILES | CCC(=O)C1=CC(=C(N=C1C)C)C(=O)N[C@@H](C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)