Products 92765-69-0
CAS 92765-69-0 is the registry number for ethyl 2-nitrilo-3-((4-methylthio(5H-2,3,5-triazolyl))amino)prop-2-enoate. Offered by: Biosynth. Available pack sizes: 250mg.
Ethyl (Z)-2-cyano-3-[(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)amino]prop-2-enoate (CAS 92765-69-0) is a chemical compound with the molecular formula C9H11N5O2S and a molecular weight of 253.28 g/mol. IUPAC name: ethyl (Z)-2-cyano-3-[(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)amino]prop-2-enoate. InChIKey: CVASRVQHUUKANB-WAYWQWQTSA-N.
| Molecular formula | C9H11N5O2S |
|---|---|
| Molecular weight | 253.28 g/mol |
| IUPAC name | ethyl (Z)-2-cyano-3-[(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)amino]prop-2-enoate |
| InChIKey | CVASRVQHUUKANB-WAYWQWQTSA-N |
| SMILES | CCOC(=O)/C(=C\NC1=NC(=NN1)SC)/C#N |
Computed by PubChem (NCBI)