Products 436086-77-0

CAS 436086-77-0 is the registry number for 2-((6-Amino-9H-purin-8-yl)thio)butanoic acid, 95%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-[(6-amino-7H-purin-8-yl)sulfanyl]butanoic acid (CAS 436086-77-0) is a chemical compound with the molecular formula C9H11N5O2S and a molecular weight of 253.28 g/mol. IUPAC name: 2-[(6-amino-7H-purin-8-yl)sulfanyl]butanoic acid. InChIKey: USXGXECUDHKQHW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11N5O2S
Molecular weight253.28 g/mol
IUPAC name2-[(6-amino-7H-purin-8-yl)sulfanyl]butanoic acid
InChIKeyUSXGXECUDHKQHW-UHFFFAOYSA-N
SMILESCCC(C(=O)O)SC1=NC2=NC=NC(=C2N1)N

Computed by PubChem (NCBI)