CAS 927679-50-3 appears in our catalog under these names: (1R,2S,5S)-Rel-methyl 3-azabicyclo[3.1.0]hexane-2-carboxylate hydrochloride, 95%, (1R,2S,5S)-rel-Methyl 3-azabicyclo(3.1.0)hexane-2-carboxylate hydrochloride, 97%, (1R,2S,5S)-rel-Methyl 3-azabicyclo(3.1.0)hexane-2-carboxylate hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g, 50mg, 0,5g.
Methyl (1R,2S,5S)-3-azabicyclo[3.1.0]hexane-2-carboxylate;hydrochloride (CAS 927679-50-3) is a chemical compound with the molecular formula C7H12ClNO2 and a molecular weight of 177.63 g/mol. IUPAC name: methyl (1R,2S,5S)-3-azabicyclo[3.1.0]hexane-2-carboxylate;hydrochloride. InChIKey: WYQMWVWFYJQAIB-JMWSHJPJSA-N.
| Molecular formula | C7H12ClNO2 |
|---|---|
| Molecular weight | 177.63 g/mol |
| IUPAC name | methyl (1R,2S,5S)-3-azabicyclo[3.1.0]hexane-2-carboxylate;hydrochloride |
| InChIKey | WYQMWVWFYJQAIB-JMWSHJPJSA-N |
| SMILES | COC(=O)[C@@H]1[C@@H]2C[C@@H]2CN1.Cl |
Computed by PubChem (NCBI)