CAS 132487-40-2 is the registry number for (1S,2R)-(-)-2-Aminocyclohex-3-enecarboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
(1S,2R)-2-aminocyclohex-3-ene-1-carboxylic acid;hydrochloride (CAS 132487-40-2) is a chemical compound with the molecular formula C7H12ClNO2 and a molecular weight of 177.63 g/mol. IUPAC name: (1S,2R)-2-aminocyclohex-3-ene-1-carboxylic acid;hydrochloride. InChIKey: UQGIRSZIKGUXTO-RIHPBJNCSA-N.
| Molecular formula | C7H12ClNO2 |
|---|---|
| Molecular weight | 177.63 g/mol |
| IUPAC name | (1S,2R)-2-aminocyclohex-3-ene-1-carboxylic acid;hydrochloride |
| InChIKey | UQGIRSZIKGUXTO-RIHPBJNCSA-N |
| SMILES | C1C[C@@H]([C@@H](C=C1)N)C(=O)O.Cl |
Computed by PubChem (NCBI)