Products 132487-40-2

CAS 132487-40-2 is the registry number for (1S,2R)-(-)-2-Aminocyclohex-3-enecarboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(1S,2R)-2-aminocyclohex-3-ene-1-carboxylic acid;hydrochloride (CAS 132487-40-2) is a chemical compound with the molecular formula C7H12ClNO2 and a molecular weight of 177.63 g/mol. IUPAC name: (1S,2R)-2-aminocyclohex-3-ene-1-carboxylic acid;hydrochloride. InChIKey: UQGIRSZIKGUXTO-RIHPBJNCSA-N.

Identity
Molecular formulaC7H12ClNO2
Molecular weight177.63 g/mol
IUPAC name(1S,2R)-2-aminocyclohex-3-ene-1-carboxylic acid;hydrochloride
InChIKeyUQGIRSZIKGUXTO-RIHPBJNCSA-N
SMILESC1C[C@@H]([C@@H](C=C1)N)C(=O)O.Cl

Computed by PubChem (NCBI)