Products 927983-55-9

CAS 927983-55-9 is the registry number for 2-(2,6-Diethylphenylamino-3,5-thiazolyl)acetic acid. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.

Structural formula: {0} (CAS {1})

2-[2-(2,6-diethylanilino)-1,3-thiazol-4-yl]acetic acid (CAS 927983-55-9) is a chemical compound with the molecular formula C15H18N2O2S and a molecular weight of 290.4 g/mol. IUPAC name: 2-[2-(2,6-diethylanilino)-1,3-thiazol-4-yl]acetic acid. InChIKey: IBIUMGADJAXNGY-UHFFFAOYSA-N.

Identity
Molecular formulaC15H18N2O2S
Molecular weight290.4 g/mol
IUPAC name2-[2-(2,6-diethylanilino)-1,3-thiazol-4-yl]acetic acid
InChIKeyIBIUMGADJAXNGY-UHFFFAOYSA-N
SMILESCCC1=C(C(=CC=C1)CC)NC2=NC(=CS2)CC(=O)O

Computed by PubChem (NCBI)